C30H22Cl3N5O — CID 74221327
(4-chlorophenyl)-[2,4-dichloro-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-6-yl]-(3-methylimidazol-4-yl)methanol (PubChem CID 74221327) has the molecular formula C30H22Cl3N5O and a molecular weight of 574.90 g/mol. Its IUPAC name is (4-chlorophenyl)-[2,4-dichloro-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-6-yl]-(3-methylimidazol-4-yl)methanol.
| Compound Name | (4-chlorophenyl)-[2,4-dichloro-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-6-yl]-(3-methylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 74221327 |
| Molecular Formula | C30H22Cl3N5O |
| Molecular Weight | 574.90 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | (4-chlorophenyl)-[2,4-dichloro-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-6-yl]-(3-methylimidazol-4-yl)methanol |
| SMILES | Cn1cncc1C(O)(c1ccc(Cl)cc1)c1ccc2nc(Cl)c(Cc3ccc(-n4cccn4)cc3)c(Cl)c2c1 |
| InChI | InChI=1S/C30H22Cl3N5O/c1-37-18-34-17-27(37)30(39,20-5-8-22(31)9-6-20)21-7-12-26-24(16-21)28(32)25(29(33)36-26)15-19-3-10-23(11-4-19)38-14-2-13-35-38/h2-14,16-18,39H,15H2,1H3 |
| InChIKey | TUVOSORVOJMOFI-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.90 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|