C23H21F2N5O2S — CID 74221385
6-fluoro-N-(6-fluoro-2-pyridinyl)-1-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]indazole-5-sulfonamide (PubChem CID 74221385) has the molecular formula C23H21F2N5O2S and a molecular weight of 469.52 g/mol. Its IUPAC name is 6-fluoro-N-(6-fluoro-2-pyridinyl)-1-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]indazole-5-sulfonamide.
| Compound Name | 6-fluoro-N-(6-fluoro-2-pyridinyl)-1-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]indazole-5-sulfonamide |
|---|---|
| PubChem CID | 74221385 |
| Molecular Formula | C23H21F2N5O2S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 6-fluoro-N-(6-fluoro-2-pyridinyl)-1-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]indazole-5-sulfonamide |
| SMILES | C[C@H](c1cccc2c1CNCC2)n1ncc2cc(S(=O)(=O)Nc3cccc(F)n3)c(F)cc21 |
| InChI | InChI=1S/C23H21F2N5O2S/c1-14(17-5-2-4-15-8-9-26-13-18(15)17)30-20-11-19(24)21(10-16(20)12-27-30)33(31,32)29-23-7-3-6-22(25)28-23/h2-7,10-12,14,26H,8-9,13H2,1H3,(H,28,29)/t14-/m1/s1 |
| InChIKey | BDXVDLWUWAYQKL-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|