C29H25FN6O3S — CID 74221575
(4S)-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine (PubChem CID 74221575) has the molecular formula C29H25FN6O3S and a molecular weight of 556.62 g/mol. Its IUPAC name is (4S)-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine.
| Compound Name | (4S)-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine |
|---|---|
| PubChem CID | 74221575 |
| Molecular Formula | C29H25FN6O3S |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | (4S)-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine |
| SMILES | COc1cnc2c(Nc3ccc4c(c3)[C@@]3(CCSC(N)=N3)c3cc(C5=CCOCC5)nc(F)c3O4)nccc2c1 |
| InChI | InChI=1S/C29H25FN6O3S/c1-37-19-12-17-4-8-32-27(24(17)33-15-19)34-18-2-3-23-20(13-18)29(7-11-40-28(31)36-29)21-14-22(16-5-9-38-10-6-16)35-26(30)25(21)39-23/h2-5,8,12-15H,6-7,9-11H2,1H3,(H2,31,36)(H,32,34)/t29-/m0/s1 |
| InChIKey | XKYAUQJQOFEOCM-LJAQVGFWSA-N |
| XLogP | 5.52 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|