C25H24F2N4O4S — CID 74221613
5-fluoro-N-(6-fluoro-2-pyridinyl)-3-[(1R)-1-(3-methyl-2-pyrrolidin-2-ylphenyl)ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 74221613) has the molecular formula C25H24F2N4O4S and a molecular weight of 514.55 g/mol. Its IUPAC name is 5-fluoro-N-(6-fluoro-2-pyridinyl)-3-[(1R)-1-(3-methyl-2-pyrrolidin-2-ylphenyl)ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 5-fluoro-N-(6-fluoro-2-pyridinyl)-3-[(1R)-1-(3-methyl-2-pyrrolidin-2-ylphenyl)ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 74221613 |
| Molecular Formula | C25H24F2N4O4S |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 5-fluoro-N-(6-fluoro-2-pyridinyl)-3-[(1R)-1-(3-methyl-2-pyrrolidin-2-ylphenyl)ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | Cc1cccc([C@@H](C)n2c(=O)oc3cc(S(=O)(=O)Nc4cccc(F)n4)c(F)cc32)c1C1CCCN1 |
| InChI | InChI=1S/C25H24F2N4O4S/c1-14-6-3-7-16(24(14)18-8-5-11-28-18)15(2)31-19-12-17(26)21(13-20(19)35-25(31)32)36(33,34)30-23-10-4-9-22(27)29-23/h3-4,6-7,9-10,12-13,15,18,28H,5,8,11H2,1-2H3,(H,29,30)/t15-,18?/m1/s1 |
| InChIKey | OGDMWSSAKMJAFR-NNJIEVJOSA-N |
| XLogP | 4.41 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|