About 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide
2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide (PubChem CID 74221638) has the molecular formula C23H19FN2O3
and a molecular weight of 390.41 g/mol. Its IUPAC name is 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide |
| PubChem CID | 74221638 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)OC(c2ccccc2)(c2ccccc2)[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C23H19FN2O3/c24-19-14-8-7-13-18(19)21-23(16-9-3-1-4-10-16,17-11-5-2-6-12-17)29-22(28)26(21)15-20(25)27/h1-14,21H,15H2,(H2,25,27)/t21-/m0/s1 |
| InChIKey | GHKLSGPVDKKCLL-NRFANRHFSA-N |
| XLogP | 3.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide?
The IUPAC name of 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide (CID 74221638) is 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide.
What is the SMILES notation for 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide?
The canonical SMILES for 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide is NC(=O)CN1C(=O)OC(c2ccccc2)(c2ccccc2)[C@@H]1c1ccccc1F.
What is the InChIKey of 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide?
The InChIKey is GHKLSGPVDKKCLL-NRFANRHFSA-N. The full InChI is InChI=1S/C23H19FN2O3/c24-19-14-8-7-13-18(19)21-23(16-9-3-1-4-10-16,17-11-5-2-6-12-17)29-22(28)26(21)15-20(25)27/h1-14,21H,15H2,(H2,25,27)/t21-/m0/s1.
What are the key properties of 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide?
2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide has a molecular weight of 390.41 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-(2-fluorophenyl)-2-oxo-5,5-diphenyl-1,3-oxazolidin-3-yl]acetamide is sourced from PubChem (CID 74221638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).