C25H28N6O3S — CID 74221662
N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 74221662) has the molecular formula C25H28N6O3S and a molecular weight of 492.61 g/mol. Its IUPAC name is N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 74221662 |
| Molecular Formula | C25H28N6O3S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2cc3ccccc3nc2OC)[nH]1 |
| InChI | InChI=1S/C25H28N6O3S/c1-26-22(32)11-5-3-4-10-19(30-24(33)21-14-27-15-35-21)23-28-13-20(29-23)17-12-16-8-6-7-9-18(16)31-25(17)34-2/h6-9,12-15,19H,3-5,10-11H2,1-2H3,(H,26,32)(H,28,29)(H,30,33)/t19-/m0/s1 |
| InChIKey | FLQZBDLXWLNEHF-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|