About 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile
2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile (PubChem CID 74221714) has the molecular formula C18H13F3N2O
and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile.
Molecular Properties
| Compound Name | 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile |
| PubChem CID | 74221714 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile |
| SMILES | N#CC(C#N)(Cc1ccc(OCC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H13F3N2O/c19-18(20,21)13-24-16-8-6-14(7-9-16)10-17(11-22,12-23)15-4-2-1-3-5-15/h1-9H,10,13H2 |
| InChIKey | CITZOSRKTCNCJK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile?
The IUPAC name of 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile (CID 74221714) is 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile.
What is the SMILES notation for 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile?
The canonical SMILES for 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile is N#CC(C#N)(Cc1ccc(OCC(F)(F)F)cc1)c1ccccc1.
What is the InChIKey of 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile?
The InChIKey is CITZOSRKTCNCJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2O/c19-18(20,21)13-24-16-8-6-14(7-9-16)10-17(11-22,12-23)15-4-2-1-3-5-15/h1-9H,10,13H2.
What are the key properties of 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile?
2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile has a molecular weight of 330.31 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]propanedinitrile is sourced from PubChem (CID 74221714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).