C9H14F2N2O3S — CID 74222035
(3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazole-6,7-diol (PubChem CID 74222035) has the molecular formula C9H14F2N2O3S and a molecular weight of 268.29 g/mol. Its IUPAC name is (3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazole-6,7-diol.
| Compound Name | (3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazole-6,7-diol |
|---|---|
| PubChem CID | 74222035 |
| Molecular Formula | C9H14F2N2O3S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazole-6,7-diol |
| SMILES | CCNC1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](C(F)F)S[C@@H]2O1 |
| InChI | InChI=1S/C9H14F2N2O3S/c1-2-12-9-13-3-4(14)5(15)6(7(10)11)17-8(3)16-9/h3-8,14-15H,2H2,1H3,(H,12,13)/t3-,4-,5+,6+,8+/m1/s1 |
| InChIKey | XIOOTZPIOHJDRM-WIKBCIAESA-N |
| XLogP | -0.22 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |