C9H15FN2O3S — CID 74222116
(3aS,5R,6S,7R,7aR)-7-fluoro-5-[(1S)-1-hydroxyethyl]-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol (PubChem CID 74222116) has the molecular formula C9H15FN2O3S and a molecular weight of 250.30 g/mol. Its IUPAC name is (3aS,5R,6S,7R,7aR)-7-fluoro-5-[(1S)-1-hydroxyethyl]-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol.
| Compound Name | (3aS,5R,6S,7R,7aR)-7-fluoro-5-[(1S)-1-hydroxyethyl]-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol |
|---|---|
| PubChem CID | 74222116 |
| Molecular Formula | C9H15FN2O3S |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (3aS,5R,6S,7R,7aR)-7-fluoro-5-[(1S)-1-hydroxyethyl]-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol |
| SMILES | CNC1=N[C@@H]2[C@@H](F)[C@H](O)[C@@H]([C@H](C)O)S[C@@H]2O1 |
| InChI | InChI=1S/C9H15FN2O3S/c1-3(13)7-6(14)4(10)5-8(16-7)15-9(11-2)12-5/h3-8,13-14H,1-2H3,(H,11,12)/t3-,4+,5+,6-,7+,8-/m0/s1 |
| InChIKey | SPFWTDOICVQDMX-MZNFZHPNSA-N |
| XLogP | -0.52 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |