C8H11F3N2O2S — CID 74222120
(3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol (PubChem CID 74222120) has the molecular formula C8H11F3N2O2S and a molecular weight of 256.25 g/mol. Its IUPAC name is (3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol.
| Compound Name | (3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol |
|---|---|
| PubChem CID | 74222120 |
| Molecular Formula | C8H11F3N2O2S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (3aS,5S,6S,7R,7aR)-5-(difluoromethyl)-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-thiopyrano[3,2-d][1,3]oxazol-6-ol |
| SMILES | CNC1=N[C@@H]2[C@@H](F)[C@H](O)[C@@H](C(F)F)S[C@@H]2O1 |
| InChI | InChI=1S/C8H11F3N2O2S/c1-12-8-13-3-2(9)4(14)5(6(10)11)16-7(3)15-8/h2-7,14H,1H3,(H,12,13)/t2-,3-,4+,5+,7+/m1/s1 |
| InChIKey | GCPIGPCFFXDKST-NRGGUMNKSA-N |
| XLogP | 0.37 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |