C20H13FO3S — CID 74222430
3-(4-fluorophenyl)-2-(4-hydroxyphenoxy)-1-benzothiophen-6-ol (PubChem CID 74222430) has the molecular formula C20H13FO3S and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-(4-hydroxyphenoxy)-1-benzothiophen-6-ol.
| Compound Name | 3-(4-fluorophenyl)-2-(4-hydroxyphenoxy)-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 74222430 |
| Molecular Formula | C20H13FO3S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-(4-fluorophenyl)-2-(4-hydroxyphenoxy)-1-benzothiophen-6-ol |
| SMILES | Oc1ccc(Oc2sc3cc(O)ccc3c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H13FO3S/c21-13-3-1-12(2-4-13)19-17-10-7-15(23)11-18(17)25-20(19)24-16-8-5-14(22)6-9-16/h1-11,22-23H |
| InChIKey | UDBMVVLTKJMPCJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |