C30H55NO3 — CID 74222640
(3S,8R,10R,12R,14R,17S)-17-[(2S)-2-hydroxy-5-(propan-2-ylamino)pentan-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol (PubChem CID 74222640) has the molecular formula C30H55NO3 and a molecular weight of 477.77 g/mol. Its IUPAC name is (3S,8R,10R,12R,14R,17S)-17-[(2S)-2-hydroxy-5-(propan-2-ylamino)pentan-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol.
| Compound Name | (3S,8R,10R,12R,14R,17S)-17-[(2S)-2-hydroxy-5-(propan-2-ylamino)pentan-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
|---|---|
| PubChem CID | 74222640 |
| Molecular Formula | C30H55NO3 |
| Molecular Weight | 477.77 g/mol |
| Exact Mass | 477.42 |
| IUPAC Name | (3S,8R,10R,12R,14R,17S)-17-[(2S)-2-hydroxy-5-(propan-2-ylamino)pentan-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
| SMILES | CC(C)NCCC[C@](C)(O)[C@H]1CC[C@]2(C)C1C(O)CC1[C@@]3(C)CC[C@H](O)C(C)(C)C3CC[C@]12C |
| InChI | InChI=1S/C30H55NO3/c1-19(2)31-17-9-13-30(8,34)20-10-15-29(7)25(20)21(32)18-23-27(5)14-12-24(33)26(3,4)22(27)11-16-28(23,29)6/h19-25,31-34H,9-18H2,1-8H3/t20-,21?,22?,23?,24-,25?,27-,28+,29+,30-/m0/s1 |
| InChIKey | BOXXTLYFEZPPGD-XYHNNOQXSA-N |
| XLogP | 5.53 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.77 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|