C25H21ClF5N3 — CID 74223129
4-[4-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylaniline (PubChem CID 74223129) has the molecular formula C25H21ClF5N3 and a molecular weight of 493.91 g/mol. Its IUPAC name is 4-[4-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylaniline.
| Compound Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 74223129 |
| Molecular Formula | C25H21ClF5N3 |
| Molecular Weight | 493.91 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2ccc(C3CC(C(F)(F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21ClF5N3/c1-33(2)19-13-11-17(12-14-19)16-7-9-18(10-8-16)22-15-23(24(27,28)25(29,30)31)32-34(22)21-6-4-3-5-20(21)26/h3-14,22H,15H2,1-2H3 |
| InChIKey | OYCJBEBDGOAHSM-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.91 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|