C24H18ClF5N2O2S — CID 74223131
2-(2-chlorophenyl)-3-[4-(3-methylsulfonylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole (PubChem CID 74223131) has the molecular formula C24H18ClF5N2O2S and a molecular weight of 528.93 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[4-(3-methylsulfonylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole.
| Compound Name | 2-(2-chlorophenyl)-3-[4-(3-methylsulfonylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 74223131 |
| Molecular Formula | C24H18ClF5N2O2S |
| Molecular Weight | 528.93 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[4-(3-methylsulfonylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(C3CC(C(F)(F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C24H18ClF5N2O2S/c1-35(33,34)18-6-4-5-17(13-18)15-9-11-16(12-10-15)21-14-22(23(26,27)24(28,29)30)31-32(21)20-8-3-2-7-19(20)25/h2-13,21H,14H2,1H3 |
| InChIKey | JTCZCKVFFOJKNW-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.93 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|