About (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol
(3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol (PubChem CID 74223160) has the molecular formula C29H22Cl3N3O
and a molecular weight of 534.87 g/mol. Its IUPAC name is (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol |
| PubChem CID | 74223160 |
| Molecular Formula | C29H22Cl3N3O |
| Molecular Weight | 534.87 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol |
| SMILES | CCN(c1ccccc1)c1c(Cl)nc2ccc(C(O)(c3cccnc3)c3cccc(Cl)c3)cc2c1Cl |
| InChI | InChI=1S/C29H22Cl3N3O/c1-2-35(23-11-4-3-5-12-23)27-26(31)24-17-20(13-14-25(24)34-28(27)32)29(36,21-9-7-15-33-18-21)19-8-6-10-22(30)16-19/h3-18,36H,2H2,1H3 |
| InChIKey | MDEOYKJUOUYVQF-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.87 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol?
The IUPAC name of (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol (CID 74223160) is (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol.
What is the SMILES notation for (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol?
The canonical SMILES for (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol is CCN(c1ccccc1)c1c(Cl)nc2ccc(C(O)(c3cccnc3)c3cccc(Cl)c3)cc2c1Cl.
What is the InChIKey of (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol?
The InChIKey is MDEOYKJUOUYVQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22Cl3N3O/c1-2-35(23-11-4-3-5-12-23)27-26(31)24-17-20(13-14-25(24)34-28(27)32)29(36,21-9-7-15-33-18-21)19-8-6-10-22(30)16-19/h3-18,36H,2H2,1H3.
What are the key properties of (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol?
(3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol has a molecular weight of 534.87 g/mol, XLogP of 8.03, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)-[2,4-dichloro-3-(N-ethylanilino)quinolin-6-yl]-pyridin-3-ylmethanol is sourced from PubChem (CID 74223160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).