C20H9ClN2O4S2 — CID 74223251
4-(3-chlorophenyl)sulfonylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione (PubChem CID 74223251) has the molecular formula C20H9ClN2O4S2 and a molecular weight of 440.89 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione.
| Compound Name | 4-(3-chlorophenyl)sulfonylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione |
|---|---|
| PubChem CID | 74223251 |
| Molecular Formula | C20H9ClN2O4S2 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(S(=O)(=O)c1cccc(Cl)c1)c1nsnc21 |
| InChI | InChI=1S/C20H9ClN2O4S2/c21-10-4-3-5-11(8-10)29(26,27)15-9-14-16(18-17(15)22-28-23-18)20(25)13-7-2-1-6-12(13)19(14)24/h1-9H |
| InChIKey | NPRFEKMRZLTXIW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|