C21H30N2O4 — CID 74223568
N-[(2S,3R)-3-hydroxy-1-(octylamino)-1-oxobutan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 74223568) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(octylamino)-1-oxobutan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(octylamino)-1-oxobutan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 74223568 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(octylamino)-1-oxobutan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | CCCCCCCCNC(=O)[C@@H](NC(=O)c1cc2ccccc2o1)[C@@H](C)O |
| InChI | InChI=1S/C21H30N2O4/c1-3-4-5-6-7-10-13-22-21(26)19(15(2)24)23-20(25)18-14-16-11-8-9-12-17(16)27-18/h8-9,11-12,14-15,19,24H,3-7,10,13H2,1-2H3,(H,22,26)(H,23,25)/t15-,19+/m1/s1 |
| InChIKey | VXPDITAXMDWBTP-BEFAXECRSA-N |
| XLogP | 3.39 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|