About 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate
3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate (PubChem CID 74223689) has the molecular formula C25H33NO4
and a molecular weight of 411.54 g/mol. Its IUPAC name is 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate |
| PubChem CID | 74223689 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate |
| SMILES | CCCCCOc1cc(C(=O)OCC=C(C)C)nc2c(OCC=C(C)C)cccc12 |
| InChI | InChI=1S/C25H33NO4/c1-6-7-8-14-28-23-17-21(25(27)30-16-13-19(4)5)26-24-20(23)10-9-11-22(24)29-15-12-18(2)3/h9-13,17H,6-8,14-16H2,1-5H3 |
| InChIKey | SBDTVNQLAFVXQD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate?
The IUPAC name of 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate (CID 74223689) is 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate.
What is the SMILES notation for 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate?
The canonical SMILES for 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate is CCCCCOc1cc(C(=O)OCC=C(C)C)nc2c(OCC=C(C)C)cccc12.
What is the InChIKey of 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate?
The InChIKey is SBDTVNQLAFVXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33NO4/c1-6-7-8-14-28-23-17-21(25(27)30-16-13-19(4)5)26-24-20(23)10-9-11-22(24)29-15-12-18(2)3/h9-13,17H,6-8,14-16H2,1-5H3.
What are the key properties of 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate?
3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate has a molecular weight of 411.54 g/mol, XLogP of 6.27, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl 8-(3-methylbut-2-enoxy)-4-pentoxyquinoline-2-carboxylate is sourced from PubChem (CID 74223689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).