C23H29N3O5 — CID 74226741
(3S)-N-tert-butyl-2-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 74226741) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is (3S)-N-tert-butyl-2-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-N-tert-butyl-2-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 74226741 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (3S)-N-tert-butyl-2-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1Cc2ccccc2CN1CC(O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H29N3O5/c1-23(2,3)24-22(28)21-12-16-6-4-5-7-17(16)13-25(21)14-19(27)15-31-20-10-8-18(9-11-20)26(29)30/h4-11,19,21,27H,12-15H2,1-3H3,(H,24,28)/t19?,21-/m0/s1 |
| InChIKey | KZQOAXNPIQYUHK-QWAKEFERSA-N |
| XLogP | 2.68 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|