C19H14Cl2N2O2 — CID 7422695
1-benzyl-N-(2,3-dichlorophenyl)-2-oxopyridine-3-carboxamide (PubChem CID 7422695) has the molecular formula C19H14Cl2N2O2 and a molecular weight of 373.24 g/mol. Its IUPAC name is 1-benzyl-N-(2,3-dichlorophenyl)-2-oxopyridine-3-carboxamide.
| Compound Name | 1-benzyl-N-(2,3-dichlorophenyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 7422695 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-benzyl-N-(2,3-dichlorophenyl)-2-oxopyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1cccn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H14Cl2N2O2/c20-15-9-4-10-16(17(15)21)22-18(24)14-8-5-11-23(19(14)25)12-13-6-2-1-3-7-13/h1-11H,12H2,(H,22,24) |
| InChIKey | VXAXFPSDPWSDCL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |