C13H20N4O2S2 — CID 74227217
(4R)-N-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-2-sulfanylidene-1,3-thiazolidine-4-carboxamide (PubChem CID 74227217) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (4R)-N-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-2-sulfanylidene-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-2-sulfanylidene-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 74227217 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (4R)-N-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-2-sulfanylidene-1,3-thiazolidine-4-carboxamide |
| SMILES | COC(C)(C)CCn1cc(NC(=O)[C@@H]2CSC(=S)N2)cn1 |
| InChI | InChI=1S/C13H20N4O2S2/c1-13(2,19-3)4-5-17-7-9(6-14-17)15-11(18)10-8-21-12(20)16-10/h6-7,10H,4-5,8H2,1-3H3,(H,15,18)(H,16,20)/t10-/m0/s1 |
| InChIKey | IOYKJYWUUHYCRU-JTQLQIEISA-N |
| XLogP | 1.63 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|