C25H29N3O2S — CID 74227488
N-[(1R,2S)-2-phenylcyclopropyl]-8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decane-2-carboxamide (PubChem CID 74227488) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[(1R,2S)-2-phenylcyclopropyl]-8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decane-2-carboxamide.
| Compound Name | N-[(1R,2S)-2-phenylcyclopropyl]-8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 74227488 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[(1R,2S)-2-phenylcyclopropyl]-8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decane-2-carboxamide |
| SMILES | O=C(/C=C/c1ccsc1)N1CCC2(CC1)CCN(C(=O)N[C@@H]1C[C@H]1c1ccccc1)C2 |
| InChI | InChI=1S/C25H29N3O2S/c29-23(7-6-19-8-15-31-17-19)27-12-9-25(10-13-27)11-14-28(18-25)24(30)26-22-16-21(22)20-4-2-1-3-5-20/h1-8,15,17,21-22H,9-14,16,18H2,(H,26,30)/b7-6+/t21-,22+/m0/s1 |
| InChIKey | IIVLHMIVNYVOTI-SUFHBLLTSA-N |
| XLogP | 4.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|