C23H29ClN4O2S — CID 74228452
N-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 74228452) has the molecular formula C23H29ClN4O2S and a molecular weight of 461.03 g/mol. Its IUPAC name is N-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | N-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 74228452 |
| Molecular Formula | C23H29ClN4O2S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)CCN(C(=S)NC2C[C@H]4C=C[C@@H]2C4)C3)cc(Cl)n1 |
| InChI | InChI=1S/C23H29ClN4O2S/c1-30-20-13-17(12-19(24)26-20)21(29)27-7-4-23(5-8-27)6-9-28(14-23)22(31)25-18-11-15-2-3-16(18)10-15/h2-3,12-13,15-16,18H,4-11,14H2,1H3,(H,25,31)/t15-,16+,18?/m0/s1 |
| InChIKey | BVZCJTJIXOOCHH-SWQDIRLTSA-N |
| XLogP | 3.51 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|