C21H26N4O5 — CID 74228459
2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(Z)-3-(furan-2-yl)prop-2-enyl]morpholine (PubChem CID 74228459) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(Z)-3-(furan-2-yl)prop-2-enyl]morpholine.
| Compound Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(Z)-3-(furan-2-yl)prop-2-enyl]morpholine |
|---|---|
| PubChem CID | 74228459 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(Z)-3-(furan-2-yl)prop-2-enyl]morpholine |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(C/C=C\c3ccco3)CCO2)n1 |
| InChI | InChI=1S/C21H26N4O5/c1-3-11-28-19-22-20(29-12-4-2)24-21(23-19)30-16-18-15-25(10-14-27-18)9-5-7-17-8-6-13-26-17/h3-8,13,18H,1-2,9-12,14-16H2/b7-5- |
| InChIKey | MOOMBIDEQKBACC-ALCCZGGFSA-N |
| XLogP | 2.39 |
| TPSA | 91.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|