About N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide
N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 74228494) has the molecular formula C17H10F6N2O2S
and a molecular weight of 420.33 g/mol. Its IUPAC name is N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 74228494 |
| Molecular Formula | C17H10F6N2O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccc2ccccc12)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F6N2O2S/c18-16(19,20)11-7-12(17(21,22)23)9-13(8-11)28(26,27)25-15-14-4-2-1-3-10(14)5-6-24-15/h1-9H,(H,24,25) |
| InChIKey | IAMWKDJTNNROTJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide (CID 74228494) is N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide is O=S(=O)(Nc1nccc2ccccc12)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide?
The InChIKey is IAMWKDJTNNROTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F6N2O2S/c18-16(19,20)11-7-12(17(21,22)23)9-13(8-11)28(26,27)25-15-14-4-2-1-3-10(14)5-6-24-15/h1-9H,(H,24,25).
What are the key properties of N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide?
N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide has a molecular weight of 420.33 g/mol, XLogP of 5.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-isoquinolin-1-yl-3,5-bis(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 74228494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).