About ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate
ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate (PubChem CID 74228946) has the molecular formula C15H18ClN3O4S
and a molecular weight of 371.85 g/mol. Its IUPAC name is ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate |
| PubChem CID | 74228946 |
| Molecular Formula | C15H18ClN3O4S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate |
| SMILES | CCOC(=O)[C@H](NS(=O)(=O)c1c(C)nn(C)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H18ClN3O4S/c1-4-23-15(20)12(11-8-6-5-7-9-11)18-24(21,22)13-10(2)17-19(3)14(13)16/h5-9,12,18H,4H2,1-3H3/t12-/m1/s1 |
| InChIKey | IOOOVWHLMAGTCW-GFCCVEGCSA-N |
| XLogP | 1.96 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate?
The IUPAC name of ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate (CID 74228946) is ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate.
What is the SMILES notation for ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate?
The canonical SMILES for ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate is CCOC(=O)[C@H](NS(=O)(=O)c1c(C)nn(C)c1Cl)c1ccccc1.
What is the InChIKey of ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate?
The InChIKey is IOOOVWHLMAGTCW-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H18ClN3O4S/c1-4-23-15(20)12(11-8-6-5-7-9-11)18-24(21,22)13-10(2)17-19(3)14(13)16/h5-9,12,18H,4H2,1-3H3/t12-/m1/s1.
What are the key properties of ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate?
ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate has a molecular weight of 371.85 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]-2-phenylacetate is sourced from PubChem (CID 74228946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).