C19H20N4O3 — CID 74229032
N-[3-[3-[(4-cyanophenyl)carbamoylamino]propoxy]phenyl]acetamide (PubChem CID 74229032) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[3-[3-[(4-cyanophenyl)carbamoylamino]propoxy]phenyl]acetamide.
| Compound Name | N-[3-[3-[(4-cyanophenyl)carbamoylamino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 74229032 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[3-[3-[(4-cyanophenyl)carbamoylamino]propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCCCNC(=O)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-14(24)22-17-4-2-5-18(12-17)26-11-3-10-21-19(25)23-16-8-6-15(13-20)7-9-16/h2,4-9,12H,3,10-11H2,1H3,(H,22,24)(H2,21,23,25) |
| InChIKey | DIWPINCDHWTENA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|