C19H16F4N4O — CID 74229078
4-(2-cyanophenyl)-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 74229078) has the molecular formula C19H16F4N4O and a molecular weight of 392.36 g/mol. Its IUPAC name is 4-(2-cyanophenyl)-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-cyanophenyl)-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 74229078 |
| Molecular Formula | C19H16F4N4O |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-(2-cyanophenyl)-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | N#Cc1ccccc1N1CCN(C(=O)Nc2c(F)cccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H16F4N4O/c20-15-6-3-5-14(19(21,22)23)17(15)25-18(28)27-10-8-26(9-11-27)16-7-2-1-4-13(16)12-24/h1-7H,8-11H2,(H,25,28) |
| InChIKey | ATXWPIKURKUPDN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |