C29H28ClF3N4O3 — CID 74229224
N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidine-4-carboxamide (PubChem CID 74229224) has the molecular formula C29H28ClF3N4O3 and a molecular weight of 573.02 g/mol. Its IUPAC name is N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidine-4-carboxamide.
| Compound Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74229224 |
| Molecular Formula | C29H28ClF3N4O3 |
| Molecular Weight | 573.02 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)C1(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CCNCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28ClF3N4O3/c30-22-11-7-20(8-12-22)25(38)35-17-18-36-27(40)28(13-15-34-16-14-28)37-26(39)24-4-2-1-3-23(24)19-5-9-21(10-6-19)29(31,32)33/h1-12,34H,13-18H2,(H,35,38)(H,36,40)(H,37,39) |
| InChIKey | KRTNPBPICTWMOI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.02 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|