About 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one
3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one (PubChem CID 74229341) has the molecular formula C18H14F2N2OS
and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one |
| PubChem CID | 74229341 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2c[nH]c3ccccc23)N1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C18H14F2N2OS/c19-12-6-5-11(15(20)7-12)9-22-17(23)10-24-18(22)14-8-21-16-4-2-1-3-13(14)16/h1-8,18,21H,9-10H2 |
| InChIKey | CMSANXBWPHQEJQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one?
The IUPAC name of 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one (CID 74229341) is 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one is O=C1CSC(c2c[nH]c3ccccc23)N1Cc1ccc(F)cc1F.
What is the InChIKey of 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one?
The InChIKey is CMSANXBWPHQEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N2OS/c19-12-6-5-11(15(20)7-12)9-22-17(23)10-24-18(22)14-8-21-16-4-2-1-3-13(14)16/h1-8,18,21H,9-10H2.
What are the key properties of 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one?
3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one has a molecular weight of 344.39 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-difluorophenyl)methyl]-2-(1H-indol-3-yl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 74229341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).