C15H22N2O3 — CID 74229542
1-benzyl-N-(1,1-dimethoxypropan-2-yl)aziridine-2-carboxamide (PubChem CID 74229542) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-benzyl-N-(1,1-dimethoxypropan-2-yl)aziridine-2-carboxamide.
| Compound Name | 1-benzyl-N-(1,1-dimethoxypropan-2-yl)aziridine-2-carboxamide |
|---|---|
| PubChem CID | 74229542 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-benzyl-N-(1,1-dimethoxypropan-2-yl)aziridine-2-carboxamide |
| SMILES | COC(OC)C(C)NC(=O)C1CN1Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c1-11(15(19-2)20-3)16-14(18)13-10-17(13)9-12-7-5-4-6-8-12/h4-8,11,13,15H,9-10H2,1-3H3,(H,16,18) |
| InChIKey | LCGSYUAMQNXDTG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|