C13H11NO7 — CID 74229599
2,2-dimethyl-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione (PubChem CID 74229599) has the molecular formula C13H11NO7 and a molecular weight of 293.23 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 74229599 |
| Molecular Formula | C13H11NO7 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2,2-dimethyl-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C/C=C/c2ccc([N+](=O)[O-])o2)C(=O)O1 |
| InChI | InChI=1S/C13H11NO7/c1-13(2)20-11(15)9(12(16)21-13)5-3-4-8-6-7-10(19-8)14(17)18/h3-7H,1-2H3/b4-3+ |
| InChIKey | QIELVBZACDOAGX-ONEGZZNKSA-N |
| XLogP | 1.96 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|