C17H20N4O — CID 74230614
2-methyl-1-[2-[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]ethyl]indole (PubChem CID 74230614) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-methyl-1-[2-[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]ethyl]indole.
| Compound Name | 2-methyl-1-[2-[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]ethyl]indole |
|---|---|
| PubChem CID | 74230614 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-methyl-1-[2-[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]ethyl]indole |
| SMILES | Cc1cc2ccccc2n1CCc1nc(C2CCOC2)n[nH]1 |
| InChI | InChI=1S/C17H20N4O/c1-12-10-13-4-2-3-5-15(13)21(12)8-6-16-18-17(20-19-16)14-7-9-22-11-14/h2-5,10,14H,6-9,11H2,1H3,(H,18,19,20) |
| InChIKey | VONFLYNGSSYLNT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |