C17H23N3OS — CID 74231673
1-[4-[[4-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone (PubChem CID 74231673) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-[4-[[4-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[[4-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 74231673 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-[4-[[4-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2CCC(Cn3ccnc3C)CC2)cs1 |
| InChI | InChI=1S/C17H23N3OS/c1-13(21)17-9-16(12-22-17)10-19-6-3-15(4-7-19)11-20-8-5-18-14(20)2/h5,8-9,12,15H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | SFVWNIFCPCFYAV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |