C15H22N2O3S — CID 7423212
N-[2-[(3S)-3-methylpiperidin-1-yl]sulfonylethyl]benzamide (PubChem CID 7423212) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[2-[(3S)-3-methylpiperidin-1-yl]sulfonylethyl]benzamide.
| Compound Name | N-[2-[(3S)-3-methylpiperidin-1-yl]sulfonylethyl]benzamide |
|---|---|
| PubChem CID | 7423212 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[2-[(3S)-3-methylpiperidin-1-yl]sulfonylethyl]benzamide |
| SMILES | C[C@H]1CCCN(S(=O)(=O)CCNC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2O3S/c1-13-6-5-10-17(12-13)21(19,20)11-9-16-15(18)14-7-3-2-4-8-14/h2-4,7-8,13H,5-6,9-12H2,1H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | ASHJNXLMQHTAHE-ZDUSSCGKSA-N |
| XLogP | 1.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |