C14H19N3S — CID 74232126
N-[(1-methylpyrazol-4-yl)methyl]-N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine (PubChem CID 74232126) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(1-methylpyrazol-4-yl)methyl]-N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine.
| Compound Name | N-[(1-methylpyrazol-4-yl)methyl]-N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 74232126 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(1-methylpyrazol-4-yl)methyl]-N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine |
| SMILES | Cc1ccc(CN(Cc2cnn(C)c2)C2CC2)s1 |
| InChI | InChI=1S/C14H19N3S/c1-11-3-6-14(18-11)10-17(13-4-5-13)9-12-7-15-16(2)8-12/h3,6-8,13H,4-5,9-10H2,1-2H3 |
| InChIKey | LSBLBFODHCNKFZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |