C15H24N4O — CID 74232495
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methylpyrazol-3-yl)urea (PubChem CID 74232495) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methylpyrazol-3-yl)urea.
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 74232495 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methylpyrazol-3-yl)urea |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)Nc1ccnn1C |
| InChI | InChI=1S/C15H24N4O/c1-12(2)6-5-7-13(3)8-10-16-15(20)18-14-9-11-17-19(14)4/h6,8-9,11H,5,7,10H2,1-4H3,(H2,16,18,20)/b13-8+ |
| InChIKey | GMXZZMQNVTYBKE-MDWZMJQESA-N |
| XLogP | 3.23 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|