C20H30N2O3 — CID 74232996
4-hydroxy-N-[[1-(4-methoxyphenyl)cyclopentyl]methyl]-1-methylpiperidine-4-carboxamide (PubChem CID 74232996) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-hydroxy-N-[[1-(4-methoxyphenyl)cyclopentyl]methyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | 4-hydroxy-N-[[1-(4-methoxyphenyl)cyclopentyl]methyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 74232996 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 4-hydroxy-N-[[1-(4-methoxyphenyl)cyclopentyl]methyl]-1-methylpiperidine-4-carboxamide |
| SMILES | COc1ccc(C2(CNC(=O)C3(O)CCN(C)CC3)CCCC2)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-22-13-11-20(24,12-14-22)18(23)21-15-19(9-3-4-10-19)16-5-7-17(25-2)8-6-16/h5-8,24H,3-4,9-15H2,1-2H3,(H,21,23) |
| InChIKey | RBQVSCGTLYBVNU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |