About [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone
[4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone (PubChem CID 74233669) has the molecular formula C16H21N3O4
and a molecular weight of 319.36 g/mol. Its IUPAC name is [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone |
| PubChem CID | 74233669 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1ocnc1C(=O)N1CCN(Cc2ccoc2)C(CCO)C1 |
| InChI | InChI=1S/C16H21N3O4/c1-12-15(17-11-23-12)16(21)19-5-4-18(14(9-19)2-6-20)8-13-3-7-22-10-13/h3,7,10-11,14,20H,2,4-6,8-9H2,1H3 |
| InChIKey | WWEFIPCYPYRYRF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone?
The IUPAC name of [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone (CID 74233669) is [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone.
What is the SMILES notation for [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone?
The canonical SMILES for [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone is Cc1ocnc1C(=O)N1CCN(Cc2ccoc2)C(CCO)C1.
What is the InChIKey of [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone?
The InChIKey is WWEFIPCYPYRYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O4/c1-12-15(17-11-23-12)16(21)19-5-4-18(14(9-19)2-6-20)8-13-3-7-22-10-13/h3,7,10-11,14,20H,2,4-6,8-9H2,1H3.
What are the key properties of [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone?
[4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone has a molecular weight of 319.36 g/mol, XLogP of 1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(furan-3-ylmethyl)-3-(2-hydroxyethyl)piperazin-1-yl]-(5-methyl-1,3-oxazol-4-yl)methanone is sourced from PubChem (CID 74233669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).