C18H24N2O2 — CID 74234867
(3aR,5S,6S,7aS)-2-[(1-methylindol-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol (PubChem CID 74234867) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3aR,5S,6S,7aS)-2-[(1-methylindol-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol.
| Compound Name | (3aR,5S,6S,7aS)-2-[(1-methylindol-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
|---|---|
| PubChem CID | 74234867 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3aR,5S,6S,7aS)-2-[(1-methylindol-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
| SMILES | Cn1c(CN2C[C@H]3C[C@H](O)[C@@H](O)C[C@H]3C2)cc2ccccc21 |
| InChI | InChI=1S/C18H24N2O2/c1-19-15(6-12-4-2-3-5-16(12)19)11-20-9-13-7-17(21)18(22)8-14(13)10-20/h2-6,13-14,17-18,21-22H,7-11H2,1H3/t13-,14+,17-,18-/m0/s1 |
| InChIKey | DHDIZVAXYKIYOG-DACLVMHWSA-N |
| XLogP | 1.74 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |