C16H24N2O4 — CID 74235668
[6-hydroxy-4-(3-methylbut-2-enyl)-1,4-diazepan-1-yl]-[5-(hydroxymethyl)furan-2-yl]methanone (PubChem CID 74235668) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is [6-hydroxy-4-(3-methylbut-2-enyl)-1,4-diazepan-1-yl]-[5-(hydroxymethyl)furan-2-yl]methanone.
| Compound Name | [6-hydroxy-4-(3-methylbut-2-enyl)-1,4-diazepan-1-yl]-[5-(hydroxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 74235668 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | [6-hydroxy-4-(3-methylbut-2-enyl)-1,4-diazepan-1-yl]-[5-(hydroxymethyl)furan-2-yl]methanone |
| SMILES | CC(C)=CCN1CCN(C(=O)c2ccc(CO)o2)CC(O)C1 |
| InChI | InChI=1S/C16H24N2O4/c1-12(2)5-6-17-7-8-18(10-13(20)9-17)16(21)15-4-3-14(11-19)22-15/h3-5,13,19-20H,6-11H2,1-2H3 |
| InChIKey | ALXKIOFNYDLNEY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|