C16H16F2N6S — CID 74235878
5-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-N,N-dimethyl-1,2,4-thiadiazol-3-amine (PubChem CID 74235878) has the molecular formula C16H16F2N6S and a molecular weight of 362.41 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-N,N-dimethyl-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-N,N-dimethyl-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 74235878 |
| Molecular Formula | C16H16F2N6S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-N,N-dimethyl-1,2,4-thiadiazol-3-amine |
| SMILES | CN(C)c1nsc(N2CCc3nc(-c4ccc(F)cc4F)[nH]c3C2)n1 |
| InChI | InChI=1S/C16H16F2N6S/c1-23(2)15-21-16(25-22-15)24-6-5-12-13(8-24)20-14(19-12)10-4-3-9(17)7-11(10)18/h3-4,7H,5-6,8H2,1-2H3,(H,19,20) |
| InChIKey | IGIYEYNPBQIBNJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |