About N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide
N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide (PubChem CID 7423599) has the molecular formula C18H23FN2O4
and a molecular weight of 350.39 g/mol. Its IUPAC name is N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide.
Molecular Properties
| Compound Name | N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide |
| PubChem CID | 7423599 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C(=O)NC[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C18H23FN2O4/c19-14-6-4-13(5-7-14)10-20-16(22)17(23)21-11-15-12-24-18(25-15)8-2-1-3-9-18/h4-7,15H,1-3,8-12H2,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | ORXLSGRUVSUVAL-HNNXBMFYSA-N |
| XLogP | 1.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
The IUPAC name of N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide (CID 7423599) is N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide.
What is the SMILES notation for N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
The canonical SMILES for N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide is O=C(NCc1ccc(F)cc1)C(=O)NC[C@H]1COC2(CCCCC2)O1.
What is the InChIKey of N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
The InChIKey is ORXLSGRUVSUVAL-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H23FN2O4/c19-14-6-4-13(5-7-14)10-20-16(22)17(23)21-11-15-12-24-18(25-15)8-2-1-3-9-18/h4-7,15H,1-3,8-12H2,(H,20,22)(H,21,23)/t15-/m0/s1.
What are the key properties of N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide has a molecular weight of 350.39 g/mol, XLogP of 1.63, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide is sourced from PubChem (CID 7423599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).