C15H23N3O2S — CID 74236218
N-(3-cyclohexylsulfanylpropyl)-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 74236218) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 74236218 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCCSC2CCCCC2)ccc1=O |
| InChI | InChI=1S/C15H23N3O2S/c1-18-14(19)9-8-13(17-18)15(20)16-10-5-11-21-12-6-3-2-4-7-12/h8-9,12H,2-7,10-11H2,1H3,(H,16,20) |
| InChIKey | AMGFQTXFDFZYRC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|