About 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol
2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol (PubChem CID 74236325) has the molecular formula C11H16N6O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol |
| PubChem CID | 74236325 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol |
| SMILES | Cc1n[nH]c(C)c1-c1cc(NCCO)nc(N)n1 |
| InChI | InChI=1S/C11H16N6O/c1-6-10(7(2)17-16-6)8-5-9(13-3-4-18)15-11(12)14-8/h5,18H,3-4H2,1-2H3,(H,16,17)(H3,12,13,14,15) |
| InChIKey | GZWQPKXNQVSZLH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol?
The IUPAC name of 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol (CID 74236325) is 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol.
What is the SMILES notation for 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol?
The canonical SMILES for 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol is Cc1n[nH]c(C)c1-c1cc(NCCO)nc(N)n1.
What is the InChIKey of 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol?
The InChIKey is GZWQPKXNQVSZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O/c1-6-10(7(2)17-16-6)8-5-9(13-3-4-18)15-11(12)14-8/h5,18H,3-4H2,1-2H3,(H,16,17)(H3,12,13,14,15).
What are the key properties of 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol?
2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol has a molecular weight of 248.29 g/mol, XLogP of 0.47, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-amino-6-(3,5-dimethyl-1H-pyrazol-4-yl)pyrimidin-4-yl]amino]ethanol is sourced from PubChem (CID 74236325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).