C17H22N2O4 — CID 7423725
N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(3-methylphenyl)oxamide (PubChem CID 7423725) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(3-methylphenyl)oxamide.
| Compound Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 7423725 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NC[C@H]2COC3(CCCC3)O2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-12-5-4-6-13(9-12)19-16(21)15(20)18-10-14-11-22-17(23-14)7-2-3-8-17/h4-6,9,14H,2-3,7-8,10-11H2,1H3,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | ITRAEDVEAQHRIZ-AWEZNQCLSA-N |
| XLogP | 1.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|