C18H20FN5O2 — CID 74237621
5-[[2-(3-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole (PubChem CID 74237621) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is 5-[[2-(3-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[2-(3-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 74237621 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 5-[[2-(3-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole |
| SMILES | COCCc1noc(CN2CCc3nc(-c4cccc(F)c4)[nH]c3C2)n1 |
| InChI | InChI=1S/C18H20FN5O2/c1-25-8-6-16-22-17(26-23-16)11-24-7-5-14-15(10-24)21-18(20-14)12-3-2-4-13(19)9-12/h2-4,9H,5-8,10-11H2,1H3,(H,20,21) |
| InChIKey | KJPXWZWLRMZSBK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |