C20H23N3 — CID 74238216
2-methyl-2-[4-[5-(pyrrolidin-1-ylmethyl)-2-pyridinyl]phenyl]propanenitrile (PubChem CID 74238216) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-methyl-2-[4-[5-(pyrrolidin-1-ylmethyl)-2-pyridinyl]phenyl]propanenitrile.
| Compound Name | 2-methyl-2-[4-[5-(pyrrolidin-1-ylmethyl)-2-pyridinyl]phenyl]propanenitrile |
|---|---|
| PubChem CID | 74238216 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-methyl-2-[4-[5-(pyrrolidin-1-ylmethyl)-2-pyridinyl]phenyl]propanenitrile |
| SMILES | CC(C)(C#N)c1ccc(-c2ccc(CN3CCCC3)cn2)cc1 |
| InChI | InChI=1S/C20H23N3/c1-20(2,15-21)18-8-6-17(7-9-18)19-10-5-16(13-22-19)14-23-11-3-4-12-23/h5-10,13H,3-4,11-12,14H2,1-2H3 |
| InChIKey | ZEYGCSPJIYXQRS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |