C13H18N4O — CID 74238300
4-cyano-1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-2-carboxamide (PubChem CID 74238300) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-cyano-1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-2-carboxamide.
| Compound Name | 4-cyano-1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 74238300 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-cyano-1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-2-carboxamide |
| SMILES | Cn1cc(C#N)cc1C(=O)NCC[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H18N4O/c1-17-9-10(8-14)7-12(17)13(18)16-6-4-11-3-2-5-15-11/h7,9,11,15H,2-6H2,1H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | NWNVRHOHAOENAQ-NSHDSACASA-N |
| XLogP | 0.77 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |