About 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea
1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea (PubChem CID 7423832) has the molecular formula C15H15N5O2S
and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea.
Molecular Properties
| Compound Name | 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea |
| PubChem CID | 7423832 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea |
| SMILES | O=C(NCCCSc1nc2ccccc2o1)Nc1ncccn1 |
| InChI | InChI=1S/C15H15N5O2S/c21-14(20-13-16-7-3-8-17-13)18-9-4-10-23-15-19-11-5-1-2-6-12(11)22-15/h1-3,5-8H,4,9-10H2,(H2,16,17,18,20,21) |
| InChIKey | CZBDNVCXSXVEQW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea?
The IUPAC name of 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea (CID 7423832) is 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea.
What is the SMILES notation for 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea?
The canonical SMILES for 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea is O=C(NCCCSc1nc2ccccc2o1)Nc1ncccn1.
What is the InChIKey of 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea?
The InChIKey is CZBDNVCXSXVEQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O2S/c21-14(20-13-16-7-3-8-17-13)18-9-4-10-23-15-19-11-5-1-2-6-12(11)22-15/h1-3,5-8H,4,9-10H2,(H2,16,17,18,20,21).
What are the key properties of 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea?
1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea has a molecular weight of 329.38 g/mol, XLogP of 2.92, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-pyrimidin-2-ylurea is sourced from PubChem (CID 7423832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).